About 4-(cyclopropylmethyl)-3-methyl-1,2,4-oxadiazol-5-one
4-(cyclopropylmethyl)-3-methyl-1,2,4-oxadiazol-5-one (PubChem CID 130637538) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 4-(cyclopropylmethyl)-3-methyl-1,2,4-oxadiazol-5-one.
Analyze 4-(cyclopropylmethyl)-3-methyl-1,2,4-oxadiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclopropylmethyl)-3-methyl-1,2,4-oxadiazol-5-one?
The IUPAC name of 4-(cyclopropylmethyl)-3-methyl-1,2,4-oxadiazol-5-one (CID 130637538) is 4-(cyclopropylmethyl)-3-methyl-1,2,4-oxadiazol-5-one.
What is the SMILES notation for 4-(cyclopropylmethyl)-3-methyl-1,2,4-oxadiazol-5-one?
The canonical SMILES for 4-(cyclopropylmethyl)-3-methyl-1,2,4-oxadiazol-5-one is Cc1noc(=O)n1CC1CC1.
What is the InChIKey of 4-(cyclopropylmethyl)-3-methyl-1,2,4-oxadiazol-5-one?
The InChIKey is WCROLRQODOEJBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-5-8-11-7(10)9(5)4-6-2-3-6/h6H,2-4H2,1H3.
What are the key properties of 4-(cyclopropylmethyl)-3-methyl-1,2,4-oxadiazol-5-one?
4-(cyclopropylmethyl)-3-methyl-1,2,4-oxadiazol-5-one has a molecular weight of 154.17 g/mol, XLogP of 0.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclopropylmethyl)-3-methyl-1,2,4-oxadiazol-5-one is sourced from PubChem (CID 130637538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).