C9H16FN3O — CID 130637858
3-fluoro-N-pyrrolidin-3-ylpyrrolidine-3-carboxamide (PubChem CID 130637858) has the molecular formula C9H16FN3O and a molecular weight of 201.24 g/mol. Its IUPAC name is 3-fluoro-N-pyrrolidin-3-ylpyrrolidine-3-carboxamide.
| Compound Name | 3-fluoro-N-pyrrolidin-3-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 130637858 |
| Molecular Formula | C9H16FN3O |
| Molecular Weight | 201.24 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 3-fluoro-N-pyrrolidin-3-ylpyrrolidine-3-carboxamide |
| SMILES | O=C(NC1CCNC1)C1(F)CCNC1 |
| InChI | InChI=1S/C9H16FN3O/c10-9(2-4-12-6-9)8(14)13-7-1-3-11-5-7/h7,11-12H,1-6H2,(H,13,14) |
| InChIKey | RQJYQFOXSXKDHI-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.24 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |