About 2,2-dichloro-N'-ethyl-N',1-dimethylcyclopropane-1-carbohydrazide
2,2-dichloro-N'-ethyl-N',1-dimethylcyclopropane-1-carbohydrazide (PubChem CID 130638290) has the molecular formula C8H14Cl2N2O
and a molecular weight of 225.12 g/mol. Its IUPAC name is 2,2-dichloro-N'-ethyl-N',1-dimethylcyclopropane-1-carbohydrazide.
Molecular Properties
| Compound Name | 2,2-dichloro-N'-ethyl-N',1-dimethylcyclopropane-1-carbohydrazide |
| PubChem CID | 130638290 |
| Molecular Formula | C8H14Cl2N2O |
| Molecular Weight | 225.12 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2,2-dichloro-N'-ethyl-N',1-dimethylcyclopropane-1-carbohydrazide |
| SMILES | CCN(C)NC(=O)C1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C8H14Cl2N2O/c1-4-12(3)11-6(13)7(2)5-8(7,9)10/h4-5H2,1-3H3,(H,11,13) |
| InChIKey | DNURYQINSHDUPV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.12 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloro-N'-ethyl-N',1-dimethylcyclopropane-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloro-N'-ethyl-N',1-dimethylcyclopropane-1-carbohydrazide?
The IUPAC name of 2,2-dichloro-N'-ethyl-N',1-dimethylcyclopropane-1-carbohydrazide (CID 130638290) is 2,2-dichloro-N'-ethyl-N',1-dimethylcyclopropane-1-carbohydrazide.
What is the SMILES notation for 2,2-dichloro-N'-ethyl-N',1-dimethylcyclopropane-1-carbohydrazide?
The canonical SMILES for 2,2-dichloro-N'-ethyl-N',1-dimethylcyclopropane-1-carbohydrazide is CCN(C)NC(=O)C1(C)CC1(Cl)Cl.
What is the InChIKey of 2,2-dichloro-N'-ethyl-N',1-dimethylcyclopropane-1-carbohydrazide?
The InChIKey is DNURYQINSHDUPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14Cl2N2O/c1-4-12(3)11-6(13)7(2)5-8(7,9)10/h4-5H2,1-3H3,(H,11,13).
What are the key properties of 2,2-dichloro-N'-ethyl-N',1-dimethylcyclopropane-1-carbohydrazide?
2,2-dichloro-N'-ethyl-N',1-dimethylcyclopropane-1-carbohydrazide has a molecular weight of 225.12 g/mol, XLogP of 1.55, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloro-N'-ethyl-N',1-dimethylcyclopropane-1-carbohydrazide is sourced from PubChem (CID 130638290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).