C9H13N3S — CID 130638361
2-methyl-5-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-1,3,4-thiadiazole (PubChem CID 130638361) has the molecular formula C9H13N3S and a molecular weight of 195.29 g/mol. Its IUPAC name is 2-methyl-5-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-1,3,4-thiadiazole.
| Compound Name | 2-methyl-5-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 130638361 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 2-methyl-5-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-1,3,4-thiadiazole |
| SMILES | CC1=CCN(c2nnc(C)s2)CC1 |
| InChI | InChI=1S/C9H13N3S/c1-7-3-5-12(6-4-7)9-11-10-8(2)13-9/h3H,4-6H2,1-2H3 |
| InChIKey | KCSNUEVZXBATCR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|