About N-but-3-en-2-yl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride
N-but-3-en-2-yl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride (PubChem CID 130639711) has the molecular formula C9H15ClF2N2O
and a molecular weight of 240.68 g/mol. Its IUPAC name is N-but-3-en-2-yl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-but-3-en-2-yl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride |
| PubChem CID | 130639711 |
| Molecular Formula | C9H15ClF2N2O |
| Molecular Weight | 240.68 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | N-but-3-en-2-yl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride |
| SMILES | C=CC(C)NC(=O)C1CC(F)(F)CN1.Cl |
| InChI | InChI=1S/C9H14F2N2O.ClH/c1-3-6(2)13-8(14)7-4-9(10,11)5-12-7;/h3,6-7,12H,1,4-5H2,2H3,(H,13,14);1H |
| InChIKey | KVECGWJOUJFLNT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.68 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-but-3-en-2-yl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-3-en-2-yl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride?
The IUPAC name of N-but-3-en-2-yl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride (CID 130639711) is N-but-3-en-2-yl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride.
What is the SMILES notation for N-but-3-en-2-yl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride?
The canonical SMILES for N-but-3-en-2-yl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride is C=CC(C)NC(=O)C1CC(F)(F)CN1.Cl.
What is the InChIKey of N-but-3-en-2-yl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride?
The InChIKey is KVECGWJOUJFLNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2N2O.ClH/c1-3-6(2)13-8(14)7-4-9(10,11)5-12-7;/h3,6-7,12H,1,4-5H2,2H3,(H,13,14);1H.
What are the key properties of N-but-3-en-2-yl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride?
N-but-3-en-2-yl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride has a molecular weight of 240.68 g/mol, XLogP of 1.10, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-3-en-2-yl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride is sourced from PubChem (CID 130639711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).