About 2-[(5-bromo-2,6-dimethylpyrimidin-4-yl)amino]propanamide
2-[(5-bromo-2,6-dimethylpyrimidin-4-yl)amino]propanamide (PubChem CID 130639933) has the molecular formula C9H13BrN4O
and a molecular weight of 273.13 g/mol. Its IUPAC name is 2-[(5-bromo-2,6-dimethylpyrimidin-4-yl)amino]propanamide.
Molecular Properties
| Compound Name | 2-[(5-bromo-2,6-dimethylpyrimidin-4-yl)amino]propanamide |
| PubChem CID | 130639933 |
| Molecular Formula | C9H13BrN4O |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 2-[(5-bromo-2,6-dimethylpyrimidin-4-yl)amino]propanamide |
| SMILES | Cc1nc(C)c(Br)c(NC(C)C(N)=O)n1 |
| InChI | InChI=1S/C9H13BrN4O/c1-4-7(10)9(14-6(3)12-4)13-5(2)8(11)15/h5H,1-3H3,(H2,11,15)(H,12,13,14) |
| InChIKey | JUYCQKLFQLHLSA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(5-bromo-2,6-dimethylpyrimidin-4-yl)amino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-bromo-2,6-dimethylpyrimidin-4-yl)amino]propanamide?
The IUPAC name of 2-[(5-bromo-2,6-dimethylpyrimidin-4-yl)amino]propanamide (CID 130639933) is 2-[(5-bromo-2,6-dimethylpyrimidin-4-yl)amino]propanamide.
What is the SMILES notation for 2-[(5-bromo-2,6-dimethylpyrimidin-4-yl)amino]propanamide?
The canonical SMILES for 2-[(5-bromo-2,6-dimethylpyrimidin-4-yl)amino]propanamide is Cc1nc(C)c(Br)c(NC(C)C(N)=O)n1.
What is the InChIKey of 2-[(5-bromo-2,6-dimethylpyrimidin-4-yl)amino]propanamide?
The InChIKey is JUYCQKLFQLHLSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BrN4O/c1-4-7(10)9(14-6(3)12-4)13-5(2)8(11)15/h5H,1-3H3,(H2,11,15)(H,12,13,14).
What are the key properties of 2-[(5-bromo-2,6-dimethylpyrimidin-4-yl)amino]propanamide?
2-[(5-bromo-2,6-dimethylpyrimidin-4-yl)amino]propanamide has a molecular weight of 273.13 g/mol, XLogP of 1.14, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-bromo-2,6-dimethylpyrimidin-4-yl)amino]propanamide is sourced from PubChem (CID 130639933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).