About 1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopentan-1-amine
1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopentan-1-amine (PubChem CID 130640668) has the molecular formula C10H18F2N2
and a molecular weight of 204.26 g/mol. Its IUPAC name is 1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopentan-1-amine.
Molecular Properties
| Compound Name | 1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopentan-1-amine |
| PubChem CID | 130640668 |
| Molecular Formula | C10H18F2N2 |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopentan-1-amine |
| SMILES | NC1(CN2CCC(F)(F)C2)CCCC1 |
| InChI | InChI=1S/C10H18F2N2/c11-10(12)5-6-14(8-10)7-9(13)3-1-2-4-9/h1-8,13H2 |
| InChIKey | LPTIJIXKQLUMJG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopentan-1-amine?
The IUPAC name of 1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopentan-1-amine (CID 130640668) is 1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopentan-1-amine.
What is the SMILES notation for 1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopentan-1-amine?
The canonical SMILES for 1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopentan-1-amine is NC1(CN2CCC(F)(F)C2)CCCC1.
What is the InChIKey of 1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopentan-1-amine?
The InChIKey is LPTIJIXKQLUMJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2/c11-10(12)5-6-14(8-10)7-9(13)3-1-2-4-9/h1-8,13H2.
What are the key properties of 1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopentan-1-amine?
1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopentan-1-amine has a molecular weight of 204.26 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,3-difluoropyrrolidin-1-yl)methyl]cyclopentan-1-amine is sourced from PubChem (CID 130640668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).