About 1-(3-methoxy-1,2-thiazol-5-yl)-2-methylpropan-1-ol
1-(3-methoxy-1,2-thiazol-5-yl)-2-methylpropan-1-ol (PubChem CID 130640794) has the molecular formula C8H13NO2S
and a molecular weight of 187.26 g/mol. Its IUPAC name is 1-(3-methoxy-1,2-thiazol-5-yl)-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 1-(3-methoxy-1,2-thiazol-5-yl)-2-methylpropan-1-ol |
| PubChem CID | 130640794 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 1-(3-methoxy-1,2-thiazol-5-yl)-2-methylpropan-1-ol |
| SMILES | COc1cc(C(O)C(C)C)sn1 |
| InChI | InChI=1S/C8H13NO2S/c1-5(2)8(10)6-4-7(11-3)9-12-6/h4-5,8,10H,1-3H3 |
| InChIKey | LPEBSPAZSRVNMH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-methoxy-1,2-thiazol-5-yl)-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methoxy-1,2-thiazol-5-yl)-2-methylpropan-1-ol?
The IUPAC name of 1-(3-methoxy-1,2-thiazol-5-yl)-2-methylpropan-1-ol (CID 130640794) is 1-(3-methoxy-1,2-thiazol-5-yl)-2-methylpropan-1-ol.
What is the SMILES notation for 1-(3-methoxy-1,2-thiazol-5-yl)-2-methylpropan-1-ol?
The canonical SMILES for 1-(3-methoxy-1,2-thiazol-5-yl)-2-methylpropan-1-ol is COc1cc(C(O)C(C)C)sn1.
What is the InChIKey of 1-(3-methoxy-1,2-thiazol-5-yl)-2-methylpropan-1-ol?
The InChIKey is LPEBSPAZSRVNMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2S/c1-5(2)8(10)6-4-7(11-3)9-12-6/h4-5,8,10H,1-3H3.
What are the key properties of 1-(3-methoxy-1,2-thiazol-5-yl)-2-methylpropan-1-ol?
1-(3-methoxy-1,2-thiazol-5-yl)-2-methylpropan-1-ol has a molecular weight of 187.26 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methoxy-1,2-thiazol-5-yl)-2-methylpropan-1-ol is sourced from PubChem (CID 130640794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).