C10H13BrN2S — CID 130641123
5-bromo-N-(cyclohex-3-en-1-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 130641123) has the molecular formula C10H13BrN2S and a molecular weight of 273.20 g/mol. Its IUPAC name is 5-bromo-N-(cyclohex-3-en-1-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-bromo-N-(cyclohex-3-en-1-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 130641123 |
| Molecular Formula | C10H13BrN2S |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 5-bromo-N-(cyclohex-3-en-1-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | Brc1cnc(NCC2CC=CCC2)s1 |
| InChI | InChI=1S/C10H13BrN2S/c11-9-7-13-10(14-9)12-6-8-4-2-1-3-5-8/h1-2,7-8H,3-6H2,(H,12,13) |
| InChIKey | WPBDHXPMPIOJLB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|