About 3-benzyl-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide
3-benzyl-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide (PubChem CID 130641224) has the molecular formula C13H12N2O2S
and a molecular weight of 260.32 g/mol. Its IUPAC name is 3-benzyl-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide.
Molecular Properties
| Compound Name | 3-benzyl-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide |
| PubChem CID | 130641224 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 3-benzyl-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide |
| SMILES | O=S1(=O)Nc2ccccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C13H12N2O2S/c16-18(17)14-12-8-4-5-9-13(12)15(18)10-11-6-2-1-3-7-11/h1-9,14H,10H2 |
| InChIKey | APFIJQABIAMYSI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzyl-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide?
The IUPAC name of 3-benzyl-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide (CID 130641224) is 3-benzyl-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide.
What is the SMILES notation for 3-benzyl-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide?
The canonical SMILES for 3-benzyl-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide is O=S1(=O)Nc2ccccc2N1Cc1ccccc1.
What is the InChIKey of 3-benzyl-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide?
The InChIKey is APFIJQABIAMYSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2S/c16-18(17)14-12-8-4-5-9-13(12)15(18)10-11-6-2-1-3-7-11/h1-9,14H,10H2.
What are the key properties of 3-benzyl-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide?
3-benzyl-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide has a molecular weight of 260.32 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide is sourced from PubChem (CID 130641224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).