C10H13F2N — CID 130642461
(1S)-1-(2,3-difluoro-4-methylphenyl)-N-methylethanamine (PubChem CID 130642461) has the molecular formula C10H13F2N and a molecular weight of 185.22 g/mol. Its IUPAC name is (1S)-1-(2,3-difluoro-4-methylphenyl)-N-methylethanamine.
| Compound Name | (1S)-1-(2,3-difluoro-4-methylphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 130642461 |
| Molecular Formula | C10H13F2N |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | (1S)-1-(2,3-difluoro-4-methylphenyl)-N-methylethanamine |
| SMILES | CN[C@@H](C)c1ccc(C)c(F)c1F |
| InChI | InChI=1S/C10H13F2N/c1-6-4-5-8(7(2)13-3)10(12)9(6)11/h4-5,7,13H,1-3H3/t7-/m0/s1 |
| InChIKey | SVMKLSTVYZJIOD-ZETCQYMHSA-N |
| XLogP | 2.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |