C10H14N2OS — CID 130642967
4-(1,2-thiazol-3-yl)-1-azabicyclo[3.2.1]octan-4-ol (PubChem CID 130642967) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 4-(1,2-thiazol-3-yl)-1-azabicyclo[3.2.1]octan-4-ol.
| Compound Name | 4-(1,2-thiazol-3-yl)-1-azabicyclo[3.2.1]octan-4-ol |
|---|---|
| PubChem CID | 130642967 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 4-(1,2-thiazol-3-yl)-1-azabicyclo[3.2.1]octan-4-ol |
| SMILES | OC1(c2ccsn2)CCN2CCC1C2 |
| InChI | InChI=1S/C10H14N2OS/c13-10(9-2-6-14-11-9)3-5-12-4-1-8(10)7-12/h2,6,8,13H,1,3-5,7H2 |
| InChIKey | JHFHFTDBENCGBX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |