About (3S)-3-amino-3-(5-bromothiophen-2-yl)-2,2-difluoropropanoic acid
(3S)-3-amino-3-(5-bromothiophen-2-yl)-2,2-difluoropropanoic acid (PubChem CID 130642996) has the molecular formula C7H6BrF2NO2S
and a molecular weight of 286.10 g/mol. Its IUPAC name is (3S)-3-amino-3-(5-bromothiophen-2-yl)-2,2-difluoropropanoic acid.
Molecular Properties
| Compound Name | (3S)-3-amino-3-(5-bromothiophen-2-yl)-2,2-difluoropropanoic acid |
| PubChem CID | 130642996 |
| Molecular Formula | C7H6BrF2NO2S |
| Molecular Weight | 286.10 g/mol |
| Exact Mass | 284.93 |
| IUPAC Name | (3S)-3-amino-3-(5-bromothiophen-2-yl)-2,2-difluoropropanoic acid |
| SMILES | N[C@H](c1ccc(Br)s1)C(F)(F)C(=O)O |
| InChI | InChI=1S/C7H6BrF2NO2S/c8-4-2-1-3(14-4)5(11)7(9,10)6(12)13/h1-2,5H,11H2,(H,12,13)/t5-/m1/s1 |
| InChIKey | MTHDGDMZVQTQJX-RXMQYKEDSA-N |
| XLogP | 2.23 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.10 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-amino-3-(5-bromothiophen-2-yl)-2,2-difluoropropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-amino-3-(5-bromothiophen-2-yl)-2,2-difluoropropanoic acid?
The IUPAC name of (3S)-3-amino-3-(5-bromothiophen-2-yl)-2,2-difluoropropanoic acid (CID 130642996) is (3S)-3-amino-3-(5-bromothiophen-2-yl)-2,2-difluoropropanoic acid.
What is the SMILES notation for (3S)-3-amino-3-(5-bromothiophen-2-yl)-2,2-difluoropropanoic acid?
The canonical SMILES for (3S)-3-amino-3-(5-bromothiophen-2-yl)-2,2-difluoropropanoic acid is N[C@H](c1ccc(Br)s1)C(F)(F)C(=O)O.
What is the InChIKey of (3S)-3-amino-3-(5-bromothiophen-2-yl)-2,2-difluoropropanoic acid?
The InChIKey is MTHDGDMZVQTQJX-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H6BrF2NO2S/c8-4-2-1-3(14-4)5(11)7(9,10)6(12)13/h1-2,5H,11H2,(H,12,13)/t5-/m1/s1.
What are the key properties of (3S)-3-amino-3-(5-bromothiophen-2-yl)-2,2-difluoropropanoic acid?
(3S)-3-amino-3-(5-bromothiophen-2-yl)-2,2-difluoropropanoic acid has a molecular weight of 286.10 g/mol, XLogP of 2.23, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-amino-3-(5-bromothiophen-2-yl)-2,2-difluoropropanoic acid is sourced from PubChem (CID 130642996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).