C8H16N2O2 — CID 130643593
N-methyl-2-[[(2R,3R)-2-methyloxolan-3-yl]amino]acetamide (PubChem CID 130643593) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is N-methyl-2-[[(2R,3R)-2-methyloxolan-3-yl]amino]acetamide.
| Compound Name | N-methyl-2-[[(2R,3R)-2-methyloxolan-3-yl]amino]acetamide |
|---|---|
| PubChem CID | 130643593 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | N-methyl-2-[[(2R,3R)-2-methyloxolan-3-yl]amino]acetamide |
| SMILES | CNC(=O)CN[C@@H]1CCO[C@@H]1C |
| InChI | InChI=1S/C8H16N2O2/c1-6-7(3-4-12-6)10-5-8(11)9-2/h6-7,10H,3-5H2,1-2H3,(H,9,11)/t6-,7-/m1/s1 |
| InChIKey | SUQLBMUVPLSNTK-RNFRBKRXSA-N |
| XLogP | -0.50 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |