About 2-[2-(1,3-dioxolan-2-yl)ethyl-methoxyamino]ethanol
2-[2-(1,3-dioxolan-2-yl)ethyl-methoxyamino]ethanol (PubChem CID 130645018) has the molecular formula C8H17NO4
and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-[2-(1,3-dioxolan-2-yl)ethyl-methoxyamino]ethanol.
Molecular Properties
| Compound Name | 2-[2-(1,3-dioxolan-2-yl)ethyl-methoxyamino]ethanol |
| PubChem CID | 130645018 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 2-[2-(1,3-dioxolan-2-yl)ethyl-methoxyamino]ethanol |
| SMILES | CON(CCO)CCC1OCCO1 |
| InChI | InChI=1S/C8H17NO4/c1-11-9(4-5-10)3-2-8-12-6-7-13-8/h8,10H,2-7H2,1H3 |
| InChIKey | XVIWCLJQQUNGKQ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(1,3-dioxolan-2-yl)ethyl-methoxyamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,3-dioxolan-2-yl)ethyl-methoxyamino]ethanol?
The IUPAC name of 2-[2-(1,3-dioxolan-2-yl)ethyl-methoxyamino]ethanol (CID 130645018) is 2-[2-(1,3-dioxolan-2-yl)ethyl-methoxyamino]ethanol.
What is the SMILES notation for 2-[2-(1,3-dioxolan-2-yl)ethyl-methoxyamino]ethanol?
The canonical SMILES for 2-[2-(1,3-dioxolan-2-yl)ethyl-methoxyamino]ethanol is CON(CCO)CCC1OCCO1.
What is the InChIKey of 2-[2-(1,3-dioxolan-2-yl)ethyl-methoxyamino]ethanol?
The InChIKey is XVIWCLJQQUNGKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO4/c1-11-9(4-5-10)3-2-8-12-6-7-13-8/h8,10H,2-7H2,1H3.
What are the key properties of 2-[2-(1,3-dioxolan-2-yl)ethyl-methoxyamino]ethanol?
2-[2-(1,3-dioxolan-2-yl)ethyl-methoxyamino]ethanol has a molecular weight of 191.23 g/mol, XLogP of -0.39, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,3-dioxolan-2-yl)ethyl-methoxyamino]ethanol is sourced from PubChem (CID 130645018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).