C8H14N4S — CID 130645888
6-methyl-2-(2-methyltriazol-4-yl)-1,3-thiazinane (PubChem CID 130645888) has the molecular formula C8H14N4S and a molecular weight of 198.29 g/mol. Its IUPAC name is 6-methyl-2-(2-methyltriazol-4-yl)-1,3-thiazinane.
| Compound Name | 6-methyl-2-(2-methyltriazol-4-yl)-1,3-thiazinane |
|---|---|
| PubChem CID | 130645888 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 6-methyl-2-(2-methyltriazol-4-yl)-1,3-thiazinane |
| SMILES | CC1CCNC(c2cnn(C)n2)S1 |
| InChI | InChI=1S/C8H14N4S/c1-6-3-4-9-8(13-6)7-5-10-12(2)11-7/h5-6,8-9H,3-4H2,1-2H3 |
| InChIKey | NRBMFHVCTKUGPO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |