About N-[4-[[3,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]acetamide
N-[4-[[3,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]acetamide (PubChem CID 13064597) has the molecular formula C18H18Cl2N4O
and a molecular weight of 377.28 g/mol. Its IUPAC name is N-[4-[[3,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[[3,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]acetamide |
| PubChem CID | 13064597 |
| Molecular Formula | C18H18Cl2N4O |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-[4-[[3,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=N/c2cc(Cl)c(/N=C/N(C)C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H18Cl2N4O/c1-12(25)23-14-6-4-13(5-7-14)10-21-15-8-16(19)18(17(20)9-15)22-11-24(2)3/h4-11H,1-3H3,(H,23,25)/b21-10+,22-11+ |
| InChIKey | JYTPKWGSNWXNIR-OIEABDAFSA-N |
| XLogP | 4.92 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[[3,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[[3,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]acetamide?
The IUPAC name of N-[4-[[3,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]acetamide (CID 13064597) is N-[4-[[3,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]acetamide.
What is the SMILES notation for N-[4-[[3,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]acetamide?
The canonical SMILES for N-[4-[[3,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]acetamide is CC(=O)Nc1ccc(/C=N/c2cc(Cl)c(/N=C/N(C)C)c(Cl)c2)cc1.
What is the InChIKey of N-[4-[[3,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]acetamide?
The InChIKey is JYTPKWGSNWXNIR-OIEABDAFSA-N. The full InChI is InChI=1S/C18H18Cl2N4O/c1-12(25)23-14-6-4-13(5-7-14)10-21-15-8-16(19)18(17(20)9-15)22-11-24(2)3/h4-11H,1-3H3,(H,23,25)/b21-10+,22-11+.
What are the key properties of N-[4-[[3,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]acetamide?
N-[4-[[3,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]acetamide has a molecular weight of 377.28 g/mol, XLogP of 4.92, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[[3,5-dichloro-4-(dimethylaminomethylideneamino)phenyl]iminomethyl]phenyl]acetamide is sourced from PubChem (CID 13064597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).