About 5-(5-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-amine
5-(5-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-amine (PubChem CID 130646137) has the molecular formula C7H5ClN4O
and a molecular weight of 196.60 g/mol. Its IUPAC name is 5-(5-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | 5-(5-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-amine |
| PubChem CID | 130646137 |
| Molecular Formula | C7H5ClN4O |
| Molecular Weight | 196.60 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 5-(5-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(-c2cncc(Cl)c2)o1 |
| InChI | InChI=1S/C7H5ClN4O/c8-5-1-4(2-10-3-5)6-11-12-7(9)13-6/h1-3H,(H2,9,12) |
| InChIKey | WFMRVHRYUADLLI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.60 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(5-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-amine?
The IUPAC name of 5-(5-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-amine (CID 130646137) is 5-(5-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for 5-(5-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-amine?
The canonical SMILES for 5-(5-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-amine is Nc1nnc(-c2cncc(Cl)c2)o1.
What is the InChIKey of 5-(5-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-amine?
The InChIKey is WFMRVHRYUADLLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN4O/c8-5-1-4(2-10-3-5)6-11-12-7(9)13-6/h1-3H,(H2,9,12).
What are the key properties of 5-(5-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-amine?
5-(5-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-amine has a molecular weight of 196.60 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 130646137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).