C10H12ClNOS — CID 130646168
(2-chlorothiophen-3-yl)-(3-methylpyrrolidin-3-yl)methanone (PubChem CID 130646168) has the molecular formula C10H12ClNOS and a molecular weight of 229.73 g/mol. Its IUPAC name is (2-chlorothiophen-3-yl)-(3-methylpyrrolidin-3-yl)methanone.
| Compound Name | (2-chlorothiophen-3-yl)-(3-methylpyrrolidin-3-yl)methanone |
|---|---|
| PubChem CID | 130646168 |
| Molecular Formula | C10H12ClNOS |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | (2-chlorothiophen-3-yl)-(3-methylpyrrolidin-3-yl)methanone |
| SMILES | CC1(C(=O)c2ccsc2Cl)CCNC1 |
| InChI | InChI=1S/C10H12ClNOS/c1-10(3-4-12-6-10)8(13)7-2-5-14-9(7)11/h2,5,12H,3-4,6H2,1H3 |
| InChIKey | LXHHOAOTZVKAAT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |