About 4,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)oxolan-3-amine
4,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)oxolan-3-amine (PubChem CID 130646323) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 4,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)oxolan-3-amine.
Molecular Properties
| Compound Name | 4,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)oxolan-3-amine |
| PubChem CID | 130646323 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 4,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)oxolan-3-amine |
| SMILES | CC1(C)COCC1NCc1ccon1 |
| InChI | InChI=1S/C10H16N2O2/c1-10(2)7-13-6-9(10)11-5-8-3-4-14-12-8/h3-4,9,11H,5-7H2,1-2H3 |
| InChIKey | SSVFGEKAHHYWEV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)oxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)oxolan-3-amine?
The IUPAC name of 4,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)oxolan-3-amine (CID 130646323) is 4,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)oxolan-3-amine.
What is the SMILES notation for 4,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)oxolan-3-amine?
The canonical SMILES for 4,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)oxolan-3-amine is CC1(C)COCC1NCc1ccon1.
What is the InChIKey of 4,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)oxolan-3-amine?
The InChIKey is SSVFGEKAHHYWEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-10(2)7-13-6-9(10)11-5-8-3-4-14-12-8/h3-4,9,11H,5-7H2,1-2H3.
What are the key properties of 4,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)oxolan-3-amine?
4,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)oxolan-3-amine has a molecular weight of 196.25 g/mol, XLogP of 1.19, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-N-(1,2-oxazol-3-ylmethyl)oxolan-3-amine is sourced from PubChem (CID 130646323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).