About [2-(3,3-difluoropyrrolidin-1-yl)cyclopentyl]methanamine
[2-(3,3-difluoropyrrolidin-1-yl)cyclopentyl]methanamine (PubChem CID 130646471) has the molecular formula C10H18F2N2
and a molecular weight of 204.26 g/mol. Its IUPAC name is [2-(3,3-difluoropyrrolidin-1-yl)cyclopentyl]methanamine.
Molecular Properties
| Compound Name | [2-(3,3-difluoropyrrolidin-1-yl)cyclopentyl]methanamine |
| PubChem CID | 130646471 |
| Molecular Formula | C10H18F2N2 |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | [2-(3,3-difluoropyrrolidin-1-yl)cyclopentyl]methanamine |
| SMILES | NCC1CCCC1N1CCC(F)(F)C1 |
| InChI | InChI=1S/C10H18F2N2/c11-10(12)4-5-14(7-10)9-3-1-2-8(9)6-13/h8-9H,1-7,13H2 |
| InChIKey | YJVKYQONGADHDB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-(3,3-difluoropyrrolidin-1-yl)cyclopentyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,3-difluoropyrrolidin-1-yl)cyclopentyl]methanamine?
The IUPAC name of [2-(3,3-difluoropyrrolidin-1-yl)cyclopentyl]methanamine (CID 130646471) is [2-(3,3-difluoropyrrolidin-1-yl)cyclopentyl]methanamine.
What is the SMILES notation for [2-(3,3-difluoropyrrolidin-1-yl)cyclopentyl]methanamine?
The canonical SMILES for [2-(3,3-difluoropyrrolidin-1-yl)cyclopentyl]methanamine is NCC1CCCC1N1CCC(F)(F)C1.
What is the InChIKey of [2-(3,3-difluoropyrrolidin-1-yl)cyclopentyl]methanamine?
The InChIKey is YJVKYQONGADHDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2/c11-10(12)4-5-14(7-10)9-3-1-2-8(9)6-13/h8-9H,1-7,13H2.
What are the key properties of [2-(3,3-difluoropyrrolidin-1-yl)cyclopentyl]methanamine?
[2-(3,3-difluoropyrrolidin-1-yl)cyclopentyl]methanamine has a molecular weight of 204.26 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,3-difluoropyrrolidin-1-yl)cyclopentyl]methanamine is sourced from PubChem (CID 130646471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).