About 4-(dimethoxymethyl)-2,2-dimethyloxolan-3-one
4-(dimethoxymethyl)-2,2-dimethyloxolan-3-one (PubChem CID 130646688) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-2,2-dimethyloxolan-3-one.
Molecular Properties
| Compound Name | 4-(dimethoxymethyl)-2,2-dimethyloxolan-3-one |
| PubChem CID | 130646688 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 4-(dimethoxymethyl)-2,2-dimethyloxolan-3-one |
| SMILES | COC(OC)C1COC(C)(C)C1=O |
| InChI | InChI=1S/C9H16O4/c1-9(2)7(10)6(5-13-9)8(11-3)12-4/h6,8H,5H2,1-4H3 |
| InChIKey | QJIIYXGBVGSFDP-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethoxymethyl)-2,2-dimethyloxolan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethoxymethyl)-2,2-dimethyloxolan-3-one?
The IUPAC name of 4-(dimethoxymethyl)-2,2-dimethyloxolan-3-one (CID 130646688) is 4-(dimethoxymethyl)-2,2-dimethyloxolan-3-one.
What is the SMILES notation for 4-(dimethoxymethyl)-2,2-dimethyloxolan-3-one?
The canonical SMILES for 4-(dimethoxymethyl)-2,2-dimethyloxolan-3-one is COC(OC)C1COC(C)(C)C1=O.
What is the InChIKey of 4-(dimethoxymethyl)-2,2-dimethyloxolan-3-one?
The InChIKey is QJIIYXGBVGSFDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c1-9(2)7(10)6(5-13-9)8(11-3)12-4/h6,8H,5H2,1-4H3.
What are the key properties of 4-(dimethoxymethyl)-2,2-dimethyloxolan-3-one?
4-(dimethoxymethyl)-2,2-dimethyloxolan-3-one has a molecular weight of 188.22 g/mol, XLogP of 0.60, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethoxymethyl)-2,2-dimethyloxolan-3-one is sourced from PubChem (CID 130646688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).