About (2R,5S)-2,5-dichloro-1,4-dithiane
(2R,5S)-2,5-dichloro-1,4-dithiane (PubChem CID 130646782) has the molecular formula C4H6Cl2S2
and a molecular weight of 189.13 g/mol. Its IUPAC name is (2R,5S)-2,5-dichloro-1,4-dithiane.
Molecular Properties
| Compound Name | (2R,5S)-2,5-dichloro-1,4-dithiane |
| PubChem CID | 130646782 |
| Molecular Formula | C4H6Cl2S2 |
| Molecular Weight | 189.13 g/mol |
| Exact Mass | 187.93 |
| IUPAC Name | (2R,5S)-2,5-dichloro-1,4-dithiane |
| SMILES | Cl[C@@H]1CS[C@@H](Cl)CS1 |
| InChI | InChI=1S/C4H6Cl2S2/c5-3-1-7-4(6)2-8-3/h3-4H,1-2H2/t3-,4+ |
| InChIKey | RFNRSHQCPMBHLC-ZXZARUISSA-N |
| XLogP | 2.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.13 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2R,5S)-2,5-dichloro-1,4-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-2,5-dichloro-1,4-dithiane?
The IUPAC name of (2R,5S)-2,5-dichloro-1,4-dithiane (CID 130646782) is (2R,5S)-2,5-dichloro-1,4-dithiane.
What is the SMILES notation for (2R,5S)-2,5-dichloro-1,4-dithiane?
The canonical SMILES for (2R,5S)-2,5-dichloro-1,4-dithiane is Cl[C@@H]1CS[C@@H](Cl)CS1.
What is the InChIKey of (2R,5S)-2,5-dichloro-1,4-dithiane?
The InChIKey is RFNRSHQCPMBHLC-ZXZARUISSA-N. The full InChI is InChI=1S/C4H6Cl2S2/c5-3-1-7-4(6)2-8-3/h3-4H,1-2H2/t3-,4+.
What are the key properties of (2R,5S)-2,5-dichloro-1,4-dithiane?
(2R,5S)-2,5-dichloro-1,4-dithiane has a molecular weight of 189.13 g/mol, XLogP of 2.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-2,5-dichloro-1,4-dithiane is sourced from PubChem (CID 130646782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).