C24H27ClN2O2 — CID 13064804
6-[3-[4-(4-chlorophenyl)piperidin-1-yl]propoxy]-4-methyl-1H-quinolin-2-one (PubChem CID 13064804) has the molecular formula C24H27ClN2O2 and a molecular weight of 410.95 g/mol. Its IUPAC name is 6-[3-[4-(4-chlorophenyl)piperidin-1-yl]propoxy]-4-methyl-1H-quinolin-2-one.
| Compound Name | 6-[3-[4-(4-chlorophenyl)piperidin-1-yl]propoxy]-4-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 13064804 |
| Molecular Formula | C24H27ClN2O2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 6-[3-[4-(4-chlorophenyl)piperidin-1-yl]propoxy]-4-methyl-1H-quinolin-2-one |
| SMILES | Cc1cc(=O)[nH]c2ccc(OCCCN3CCC(c4ccc(Cl)cc4)CC3)cc12 |
| InChI | InChI=1S/C24H27ClN2O2/c1-17-15-24(28)26-23-8-7-21(16-22(17)23)29-14-2-11-27-12-9-19(10-13-27)18-3-5-20(25)6-4-18/h3-8,15-16,19H,2,9-14H2,1H3,(H,26,28) |
| InChIKey | OFCHSWJLZFAPHT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|