C10H11BrO3S — CID 130648429
2-[(2-bromothiophen-3-yl)methyl]oxolane-2-carboxylic acid (PubChem CID 130648429) has the molecular formula C10H11BrO3S and a molecular weight of 291.17 g/mol. Its IUPAC name is 2-[(2-bromothiophen-3-yl)methyl]oxolane-2-carboxylic acid.
| Compound Name | 2-[(2-bromothiophen-3-yl)methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 130648429 |
| Molecular Formula | C10H11BrO3S |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 289.96 |
| IUPAC Name | 2-[(2-bromothiophen-3-yl)methyl]oxolane-2-carboxylic acid |
| SMILES | O=C(O)C1(Cc2ccsc2Br)CCCO1 |
| InChI | InChI=1S/C10H11BrO3S/c11-8-7(2-5-15-8)6-10(9(12)13)3-1-4-14-10/h2,5H,1,3-4,6H2,(H,12,13) |
| InChIKey | YYLIMBAGNWIDIO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |