C9H15NO4 — CID 130649320
1-[(2R)-2-hydroxypropanoyl]piperidine-3-carboxylic acid (PubChem CID 130649320) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxypropanoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(2R)-2-hydroxypropanoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 130649320 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 1-[(2R)-2-hydroxypropanoyl]piperidine-3-carboxylic acid |
| SMILES | C[C@@H](O)C(=O)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C9H15NO4/c1-6(11)8(12)10-4-2-3-7(5-10)9(13)14/h6-7,11H,2-5H2,1H3,(H,13,14)/t6-,7?/m1/s1 |
| InChIKey | QIVHLCWTBRJAEJ-ULUSZKPHSA-N |
| XLogP | -0.31 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |