About (3,3-difluoroazetidin-1-yl)-(1,3-oxazol-5-yl)methanone
(3,3-difluoroazetidin-1-yl)-(1,3-oxazol-5-yl)methanone (PubChem CID 130649683) has the molecular formula C7H6F2N2O2
and a molecular weight of 188.13 g/mol. Its IUPAC name is (3,3-difluoroazetidin-1-yl)-(1,3-oxazol-5-yl)methanone.
Molecular Properties
| Compound Name | (3,3-difluoroazetidin-1-yl)-(1,3-oxazol-5-yl)methanone |
| PubChem CID | 130649683 |
| Molecular Formula | C7H6F2N2O2 |
| Molecular Weight | 188.13 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | (3,3-difluoroazetidin-1-yl)-(1,3-oxazol-5-yl)methanone |
| SMILES | O=C(c1cnco1)N1CC(F)(F)C1 |
| InChI | InChI=1S/C7H6F2N2O2/c8-7(9)2-11(3-7)6(12)5-1-10-4-13-5/h1,4H,2-3H2 |
| InChIKey | ANCNWXYNRSOZOW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.13 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,3-difluoroazetidin-1-yl)-(1,3-oxazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-difluoroazetidin-1-yl)-(1,3-oxazol-5-yl)methanone?
The IUPAC name of (3,3-difluoroazetidin-1-yl)-(1,3-oxazol-5-yl)methanone (CID 130649683) is (3,3-difluoroazetidin-1-yl)-(1,3-oxazol-5-yl)methanone.
What is the SMILES notation for (3,3-difluoroazetidin-1-yl)-(1,3-oxazol-5-yl)methanone?
The canonical SMILES for (3,3-difluoroazetidin-1-yl)-(1,3-oxazol-5-yl)methanone is O=C(c1cnco1)N1CC(F)(F)C1.
What is the InChIKey of (3,3-difluoroazetidin-1-yl)-(1,3-oxazol-5-yl)methanone?
The InChIKey is ANCNWXYNRSOZOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2N2O2/c8-7(9)2-11(3-7)6(12)5-1-10-4-13-5/h1,4H,2-3H2.
What are the key properties of (3,3-difluoroazetidin-1-yl)-(1,3-oxazol-5-yl)methanone?
(3,3-difluoroazetidin-1-yl)-(1,3-oxazol-5-yl)methanone has a molecular weight of 188.13 g/mol, XLogP of 0.77, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-difluoroazetidin-1-yl)-(1,3-oxazol-5-yl)methanone is sourced from PubChem (CID 130649683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).