About 1-(chloromethylsulfonyl)-3,3-dimethylazetidine
1-(chloromethylsulfonyl)-3,3-dimethylazetidine (PubChem CID 130649715) has the molecular formula C6H12ClNO2S
and a molecular weight of 197.69 g/mol. Its IUPAC name is 1-(chloromethylsulfonyl)-3,3-dimethylazetidine.
Molecular Properties
| Compound Name | 1-(chloromethylsulfonyl)-3,3-dimethylazetidine |
| PubChem CID | 130649715 |
| Molecular Formula | C6H12ClNO2S |
| Molecular Weight | 197.69 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 1-(chloromethylsulfonyl)-3,3-dimethylazetidine |
| SMILES | CC1(C)CN(S(=O)(=O)CCl)C1 |
| InChI | InChI=1S/C6H12ClNO2S/c1-6(2)3-8(4-6)11(9,10)5-7/h3-5H2,1-2H3 |
| InChIKey | CLYQCIIZNRGSKU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.69 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(chloromethylsulfonyl)-3,3-dimethylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(chloromethylsulfonyl)-3,3-dimethylazetidine?
The IUPAC name of 1-(chloromethylsulfonyl)-3,3-dimethylazetidine (CID 130649715) is 1-(chloromethylsulfonyl)-3,3-dimethylazetidine.
What is the SMILES notation for 1-(chloromethylsulfonyl)-3,3-dimethylazetidine?
The canonical SMILES for 1-(chloromethylsulfonyl)-3,3-dimethylazetidine is CC1(C)CN(S(=O)(=O)CCl)C1.
What is the InChIKey of 1-(chloromethylsulfonyl)-3,3-dimethylazetidine?
The InChIKey is CLYQCIIZNRGSKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12ClNO2S/c1-6(2)3-8(4-6)11(9,10)5-7/h3-5H2,1-2H3.
What are the key properties of 1-(chloromethylsulfonyl)-3,3-dimethylazetidine?
1-(chloromethylsulfonyl)-3,3-dimethylazetidine has a molecular weight of 197.69 g/mol, XLogP of 0.85, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(chloromethylsulfonyl)-3,3-dimethylazetidine is sourced from PubChem (CID 130649715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).