C9H11NOS — CID 130649840
1-(1,2-thiazol-3-yl)cyclohex-2-en-1-ol (PubChem CID 130649840) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is 1-(1,2-thiazol-3-yl)cyclohex-2-en-1-ol.
| Compound Name | 1-(1,2-thiazol-3-yl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 130649840 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 1-(1,2-thiazol-3-yl)cyclohex-2-en-1-ol |
| SMILES | OC1(c2ccsn2)C=CCCC1 |
| InChI | InChI=1S/C9H11NOS/c11-9(5-2-1-3-6-9)8-4-7-12-10-8/h2,4-5,7,11H,1,3,6H2 |
| InChIKey | ZNSQHFKTBXEGDN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|