About N-methyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)acetamide
N-methyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)acetamide (PubChem CID 130650283) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is N-methyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-methyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)acetamide |
| PubChem CID | 130650283 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N-methyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)acetamide |
| SMILES | CNC(=O)CN1CC=C(C)CC1 |
| InChI | InChI=1S/C9H16N2O/c1-8-3-5-11(6-4-8)7-9(12)10-2/h3H,4-7H2,1-2H3,(H,10,12) |
| InChIKey | ANUZWJCPIYCBFF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)acetamide?
The IUPAC name of N-methyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)acetamide (CID 130650283) is N-methyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)acetamide.
What is the SMILES notation for N-methyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)acetamide?
The canonical SMILES for N-methyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)acetamide is CNC(=O)CN1CC=C(C)CC1.
What is the InChIKey of N-methyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)acetamide?
The InChIKey is ANUZWJCPIYCBFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-8-3-5-11(6-4-8)7-9(12)10-2/h3H,4-7H2,1-2H3,(H,10,12).
What are the key properties of N-methyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)acetamide?
N-methyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)acetamide has a molecular weight of 168.24 g/mol, XLogP of 0.38, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)acetamide is sourced from PubChem (CID 130650283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).