C8H8Br2FN — CID 130650384
2,6-dibromo-N-ethyl-4-fluoroaniline (PubChem CID 130650384) has the molecular formula C8H8Br2FN and a molecular weight of 296.96 g/mol. Its IUPAC name is 2,6-dibromo-N-ethyl-4-fluoroaniline.
| Compound Name | 2,6-dibromo-N-ethyl-4-fluoroaniline |
|---|---|
| PubChem CID | 130650384 |
| Molecular Formula | C8H8Br2FN |
| Molecular Weight | 296.96 g/mol |
| Exact Mass | 294.90 |
| IUPAC Name | 2,6-dibromo-N-ethyl-4-fluoroaniline |
| SMILES | CCNc1c(Br)cc(F)cc1Br |
| InChI | InChI=1S/C8H8Br2FN/c1-2-12-8-6(9)3-5(11)4-7(8)10/h3-4,12H,2H2,1H3 |
| InChIKey | RXWJUFPQTOVVGM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.96 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |