About 2-(2-amino-1,3-thiazol-5-yl)-1-ethylimidazolidin-4-one
2-(2-amino-1,3-thiazol-5-yl)-1-ethylimidazolidin-4-one (PubChem CID 130650760) has the molecular formula C8H12N4OS
and a molecular weight of 212.28 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-5-yl)-1-ethylimidazolidin-4-one.
Molecular Properties
| Compound Name | 2-(2-amino-1,3-thiazol-5-yl)-1-ethylimidazolidin-4-one |
| PubChem CID | 130650760 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-5-yl)-1-ethylimidazolidin-4-one |
| SMILES | CCN1CC(=O)NC1c1cnc(N)s1 |
| InChI | InChI=1S/C8H12N4OS/c1-2-12-4-6(13)11-7(12)5-3-10-8(9)14-5/h3,7H,2,4H2,1H3,(H2,9,10)(H,11,13) |
| InChIKey | NPRICLOMRLHBFY-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-amino-1,3-thiazol-5-yl)-1-ethylimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-1,3-thiazol-5-yl)-1-ethylimidazolidin-4-one?
The IUPAC name of 2-(2-amino-1,3-thiazol-5-yl)-1-ethylimidazolidin-4-one (CID 130650760) is 2-(2-amino-1,3-thiazol-5-yl)-1-ethylimidazolidin-4-one.
What is the SMILES notation for 2-(2-amino-1,3-thiazol-5-yl)-1-ethylimidazolidin-4-one?
The canonical SMILES for 2-(2-amino-1,3-thiazol-5-yl)-1-ethylimidazolidin-4-one is CCN1CC(=O)NC1c1cnc(N)s1.
What is the InChIKey of 2-(2-amino-1,3-thiazol-5-yl)-1-ethylimidazolidin-4-one?
The InChIKey is NPRICLOMRLHBFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4OS/c1-2-12-4-6(13)11-7(12)5-3-10-8(9)14-5/h3,7H,2,4H2,1H3,(H2,9,10)(H,11,13).
What are the key properties of 2-(2-amino-1,3-thiazol-5-yl)-1-ethylimidazolidin-4-one?
2-(2-amino-1,3-thiazol-5-yl)-1-ethylimidazolidin-4-one has a molecular weight of 212.28 g/mol, XLogP of 0.18, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-1,3-thiazol-5-yl)-1-ethylimidazolidin-4-one is sourced from PubChem (CID 130650760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).