C7H6BrN3OS — CID 130651928
5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 130651928) has the molecular formula C7H6BrN3OS and a molecular weight of 260.12 g/mol. Its IUPAC name is 5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 130651928 |
| Molecular Formula | C7H6BrN3OS |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 258.94 |
| IUPAC Name | 5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | Brc1cnc(NCc2cocn2)s1 |
| InChI | InChI=1S/C7H6BrN3OS/c8-6-2-10-7(13-6)9-1-5-3-12-4-11-5/h2-4H,1H2,(H,9,10) |
| InChIKey | DDXYYTAHPMRMDS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |