About 5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine
5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 130651928) has the molecular formula C7H6BrN3OS
and a molecular weight of 260.12 g/mol. Its IUPAC name is 5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine |
| PubChem CID | 130651928 |
| Molecular Formula | C7H6BrN3OS |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 258.94 |
| IUPAC Name | 5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | Brc1cnc(NCc2cocn2)s1 |
| InChI | InChI=1S/C7H6BrN3OS/c8-6-2-10-7(13-6)9-1-5-3-12-4-11-5/h2-4H,1H2,(H,9,10) |
| InChIKey | DDXYYTAHPMRMDS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine?
The IUPAC name of 5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine (CID 130651928) is 5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine?
The canonical SMILES for 5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine is Brc1cnc(NCc2cocn2)s1.
What is the InChIKey of 5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine?
The InChIKey is DDXYYTAHPMRMDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN3OS/c8-6-2-10-7(13-6)9-1-5-3-12-4-11-5/h2-4H,1H2,(H,9,10).
What are the key properties of 5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine?
5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine has a molecular weight of 260.12 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(1,3-oxazol-4-ylmethyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 130651928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).