C7H11N3O2S — CID 130652327
3-methylsulfinyl-N-(1H-pyrazol-5-yl)propanamide (PubChem CID 130652327) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is 3-methylsulfinyl-N-(1H-pyrazol-5-yl)propanamide.
| Compound Name | 3-methylsulfinyl-N-(1H-pyrazol-5-yl)propanamide |
|---|---|
| PubChem CID | 130652327 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 3-methylsulfinyl-N-(1H-pyrazol-5-yl)propanamide |
| SMILES | CS(=O)CCC(=O)Nc1ccn[nH]1 |
| InChI | InChI=1S/C7H11N3O2S/c1-13(12)5-3-7(11)9-6-2-4-8-10-6/h2,4H,3,5H2,1H3,(H2,8,9,10,11) |
| InChIKey | DRDPZHAXZBUWTG-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |