C8H15FN2O — CID 130652438
N-[(2S)-1-aminopropan-2-yl]-2-fluoro-3-methylbut-2-enamide (PubChem CID 130652438) has the molecular formula C8H15FN2O and a molecular weight of 174.22 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-2-fluoro-3-methylbut-2-enamide.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-2-fluoro-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 130652438 |
| Molecular Formula | C8H15FN2O |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-2-fluoro-3-methylbut-2-enamide |
| SMILES | CC(C)=C(F)C(=O)N[C@@H](C)CN |
| InChI | InChI=1S/C8H15FN2O/c1-5(2)7(9)8(12)11-6(3)4-10/h6H,4,10H2,1-3H3,(H,11,12)/t6-/m0/s1 |
| InChIKey | VNJRJAGSPLAIGK-LURJTMIESA-N |
| XLogP | 0.71 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|