About 1-ethenylsulfonyl-3,3-dimethylazetidine
1-ethenylsulfonyl-3,3-dimethylazetidine (PubChem CID 130652627) has the molecular formula C7H13NO2S
and a molecular weight of 175.25 g/mol. Its IUPAC name is 1-ethenylsulfonyl-3,3-dimethylazetidine.
Molecular Properties
| Compound Name | 1-ethenylsulfonyl-3,3-dimethylazetidine |
| PubChem CID | 130652627 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 1-ethenylsulfonyl-3,3-dimethylazetidine |
| SMILES | C=CS(=O)(=O)N1CC(C)(C)C1 |
| InChI | InChI=1S/C7H13NO2S/c1-4-11(9,10)8-5-7(2,3)6-8/h4H,1,5-6H2,2-3H3 |
| InChIKey | CJQRCORIRFUNCU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethenylsulfonyl-3,3-dimethylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylsulfonyl-3,3-dimethylazetidine?
The IUPAC name of 1-ethenylsulfonyl-3,3-dimethylazetidine (CID 130652627) is 1-ethenylsulfonyl-3,3-dimethylazetidine.
What is the SMILES notation for 1-ethenylsulfonyl-3,3-dimethylazetidine?
The canonical SMILES for 1-ethenylsulfonyl-3,3-dimethylazetidine is C=CS(=O)(=O)N1CC(C)(C)C1.
What is the InChIKey of 1-ethenylsulfonyl-3,3-dimethylazetidine?
The InChIKey is CJQRCORIRFUNCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2S/c1-4-11(9,10)8-5-7(2,3)6-8/h4H,1,5-6H2,2-3H3.
What are the key properties of 1-ethenylsulfonyl-3,3-dimethylazetidine?
1-ethenylsulfonyl-3,3-dimethylazetidine has a molecular weight of 175.25 g/mol, XLogP of 0.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylsulfonyl-3,3-dimethylazetidine is sourced from PubChem (CID 130652627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).