About N-(cyanomethyl)-2-(1,3-dioxan-2-yl)acetamide
N-(cyanomethyl)-2-(1,3-dioxan-2-yl)acetamide (PubChem CID 130652686) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is N-(cyanomethyl)-2-(1,3-dioxan-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-2-(1,3-dioxan-2-yl)acetamide |
| PubChem CID | 130652686 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | N-(cyanomethyl)-2-(1,3-dioxan-2-yl)acetamide |
| SMILES | N#CCNC(=O)CC1OCCCO1 |
| InChI | InChI=1S/C8H12N2O3/c9-2-3-10-7(11)6-8-12-4-1-5-13-8/h8H,1,3-6H2,(H,10,11) |
| InChIKey | QBUCJCWVMCCVDE-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-2-(1,3-dioxan-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-2-(1,3-dioxan-2-yl)acetamide?
The IUPAC name of N-(cyanomethyl)-2-(1,3-dioxan-2-yl)acetamide (CID 130652686) is N-(cyanomethyl)-2-(1,3-dioxan-2-yl)acetamide.
What is the SMILES notation for N-(cyanomethyl)-2-(1,3-dioxan-2-yl)acetamide?
The canonical SMILES for N-(cyanomethyl)-2-(1,3-dioxan-2-yl)acetamide is N#CCNC(=O)CC1OCCCO1.
What is the InChIKey of N-(cyanomethyl)-2-(1,3-dioxan-2-yl)acetamide?
The InChIKey is QBUCJCWVMCCVDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3/c9-2-3-10-7(11)6-8-12-4-1-5-13-8/h8H,1,3-6H2,(H,10,11).
What are the key properties of N-(cyanomethyl)-2-(1,3-dioxan-2-yl)acetamide?
N-(cyanomethyl)-2-(1,3-dioxan-2-yl)acetamide has a molecular weight of 184.19 g/mol, XLogP of -0.22, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-2-(1,3-dioxan-2-yl)acetamide is sourced from PubChem (CID 130652686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).