About N-(2-chloroprop-2-enyl)-1,3-thiazole-2-carboxamide
N-(2-chloroprop-2-enyl)-1,3-thiazole-2-carboxamide (PubChem CID 130653890) has the molecular formula C7H7ClN2OS
and a molecular weight of 202.67 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N-(2-chloroprop-2-enyl)-1,3-thiazole-2-carboxamide |
| PubChem CID | 130653890 |
| Molecular Formula | C7H7ClN2OS |
| Molecular Weight | 202.67 g/mol |
| Exact Mass | 202.00 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-1,3-thiazole-2-carboxamide |
| SMILES | C=C(Cl)CNC(=O)c1nccs1 |
| InChI | InChI=1S/C7H7ClN2OS/c1-5(8)4-10-6(11)7-9-2-3-12-7/h2-3H,1,4H2,(H,10,11) |
| InChIKey | GXVJVKBPISCYQO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.67 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-chloroprop-2-enyl)-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloroprop-2-enyl)-1,3-thiazole-2-carboxamide?
The IUPAC name of N-(2-chloroprop-2-enyl)-1,3-thiazole-2-carboxamide (CID 130653890) is N-(2-chloroprop-2-enyl)-1,3-thiazole-2-carboxamide.
What is the SMILES notation for N-(2-chloroprop-2-enyl)-1,3-thiazole-2-carboxamide?
The canonical SMILES for N-(2-chloroprop-2-enyl)-1,3-thiazole-2-carboxamide is C=C(Cl)CNC(=O)c1nccs1.
What is the InChIKey of N-(2-chloroprop-2-enyl)-1,3-thiazole-2-carboxamide?
The InChIKey is GXVJVKBPISCYQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN2OS/c1-5(8)4-10-6(11)7-9-2-3-12-7/h2-3H,1,4H2,(H,10,11).
What are the key properties of N-(2-chloroprop-2-enyl)-1,3-thiazole-2-carboxamide?
N-(2-chloroprop-2-enyl)-1,3-thiazole-2-carboxamide has a molecular weight of 202.67 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloroprop-2-enyl)-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 130653890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).