C11H13N3 — CID 130654199
(3S)-3,7-diamino-6-methyl-2,3-dihydro-1H-indene-4-carbonitrile (PubChem CID 130654199) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is (3S)-3,7-diamino-6-methyl-2,3-dihydro-1H-indene-4-carbonitrile.
| Compound Name | (3S)-3,7-diamino-6-methyl-2,3-dihydro-1H-indene-4-carbonitrile |
|---|---|
| PubChem CID | 130654199 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | (3S)-3,7-diamino-6-methyl-2,3-dihydro-1H-indene-4-carbonitrile |
| SMILES | Cc1cc(C#N)c2c(c1N)CC[C@@H]2N |
| InChI | InChI=1S/C11H13N3/c1-6-4-7(5-12)10-8(11(6)14)2-3-9(10)13/h4,9H,2-3,13-14H2,1H3/t9-/m0/s1 |
| InChIKey | NXTWDAUZOJVNMX-VIFPVBQESA-N |
| XLogP | 1.39 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|