C18H17F2NO2 — CID 130655833
1-benzyl-3,3-difluoro-4-(phenylmethoxymethyl)azetidin-2-one (PubChem CID 130655833) has the molecular formula C18H17F2NO2 and a molecular weight of 317.33 g/mol. Its IUPAC name is 1-benzyl-3,3-difluoro-4-(phenylmethoxymethyl)azetidin-2-one.
| Compound Name | 1-benzyl-3,3-difluoro-4-(phenylmethoxymethyl)azetidin-2-one |
|---|---|
| PubChem CID | 130655833 |
| Molecular Formula | C18H17F2NO2 |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-benzyl-3,3-difluoro-4-(phenylmethoxymethyl)azetidin-2-one |
| SMILES | O=C1N(Cc2ccccc2)C(COCc2ccccc2)C1(F)F |
| InChI | InChI=1S/C18H17F2NO2/c19-18(20)16(13-23-12-15-9-5-2-6-10-15)21(17(18)22)11-14-7-3-1-4-8-14/h1-10,16H,11-13H2 |
| InChIKey | XQDBCAWTOPHPRV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |