About (4R)-4-tert-butyl-2,2-dimethyl-1,3-oxazolidine
(4R)-4-tert-butyl-2,2-dimethyl-1,3-oxazolidine (PubChem CID 130656460) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is (4R)-4-tert-butyl-2,2-dimethyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | (4R)-4-tert-butyl-2,2-dimethyl-1,3-oxazolidine |
| PubChem CID | 130656460 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (4R)-4-tert-butyl-2,2-dimethyl-1,3-oxazolidine |
| SMILES | CC1(C)N[C@H](C(C)(C)C)CO1 |
| InChI | InChI=1S/C9H19NO/c1-8(2,3)7-6-11-9(4,5)10-7/h7,10H,6H2,1-5H3/t7-/m0/s1 |
| InChIKey | IIIAKMITIUXECB-ZETCQYMHSA-N |
| XLogP | 1.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-tert-butyl-2,2-dimethyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-tert-butyl-2,2-dimethyl-1,3-oxazolidine?
The IUPAC name of (4R)-4-tert-butyl-2,2-dimethyl-1,3-oxazolidine (CID 130656460) is (4R)-4-tert-butyl-2,2-dimethyl-1,3-oxazolidine.
What is the SMILES notation for (4R)-4-tert-butyl-2,2-dimethyl-1,3-oxazolidine?
The canonical SMILES for (4R)-4-tert-butyl-2,2-dimethyl-1,3-oxazolidine is CC1(C)N[C@H](C(C)(C)C)CO1.
What is the InChIKey of (4R)-4-tert-butyl-2,2-dimethyl-1,3-oxazolidine?
The InChIKey is IIIAKMITIUXECB-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H19NO/c1-8(2,3)7-6-11-9(4,5)10-7/h7,10H,6H2,1-5H3/t7-/m0/s1.
What are the key properties of (4R)-4-tert-butyl-2,2-dimethyl-1,3-oxazolidine?
(4R)-4-tert-butyl-2,2-dimethyl-1,3-oxazolidine has a molecular weight of 157.26 g/mol, XLogP of 1.76, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-tert-butyl-2,2-dimethyl-1,3-oxazolidine is sourced from PubChem (CID 130656460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).