C9H19FSi — CID 13065753
[(E,3R)-3,4-dimethylpent-1-enyl]-fluoro-dimethylsilane (PubChem CID 13065753) has the molecular formula C9H19FSi and a molecular weight of 174.33 g/mol. Its IUPAC name is [(E,3R)-3,4-dimethylpent-1-enyl]-fluoro-dimethylsilane.
| Compound Name | [(E,3R)-3,4-dimethylpent-1-enyl]-fluoro-dimethylsilane |
|---|---|
| PubChem CID | 13065753 |
| Molecular Formula | C9H19FSi |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | [(E,3R)-3,4-dimethylpent-1-enyl]-fluoro-dimethylsilane |
| SMILES | CC(C)[C@@H](C)/C=C/[Si](C)(C)F |
| InChI | InChI=1S/C9H19FSi/c1-8(2)9(3)6-7-11(4,5)10/h6-9H,1-5H3/b7-6+/t9-/m0/s1 |
| InChIKey | IBZRMPHSYHSDFK-UCUJLANTSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|