C10H20N2S2 — CID 130659365
5-[[(3S)-piperidin-3-yl]methyl]-1,2,5-dithiazepane (PubChem CID 130659365) has the molecular formula C10H20N2S2 and a molecular weight of 232.42 g/mol. Its IUPAC name is 5-[[(3S)-piperidin-3-yl]methyl]-1,2,5-dithiazepane.
| Compound Name | 5-[[(3S)-piperidin-3-yl]methyl]-1,2,5-dithiazepane |
|---|---|
| PubChem CID | 130659365 |
| Molecular Formula | C10H20N2S2 |
| Molecular Weight | 232.42 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 5-[[(3S)-piperidin-3-yl]methyl]-1,2,5-dithiazepane |
| SMILES | C1CNC[C@@H](CN2CCSSCC2)C1 |
| InChI | InChI=1S/C10H20N2S2/c1-2-10(8-11-3-1)9-12-4-6-13-14-7-5-12/h10-11H,1-9H2/t10-/m0/s1 |
| InChIKey | PBQUZXVPCAOHQQ-JTQLQIEISA-N |
| XLogP | 1.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|