About (2S)-2,4-bis(hydroxymethyl)-2,3-dihydropyran-6-one
(2S)-2,4-bis(hydroxymethyl)-2,3-dihydropyran-6-one (PubChem CID 130660381) has the molecular formula C7H10O4
and a molecular weight of 158.15 g/mol. Its IUPAC name is (2S)-2,4-bis(hydroxymethyl)-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | (2S)-2,4-bis(hydroxymethyl)-2,3-dihydropyran-6-one |
| PubChem CID | 130660381 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | (2S)-2,4-bis(hydroxymethyl)-2,3-dihydropyran-6-one |
| SMILES | O=C1C=C(CO)C[C@@H](CO)O1 |
| InChI | InChI=1S/C7H10O4/c8-3-5-1-6(4-9)11-7(10)2-5/h2,6,8-9H,1,3-4H2/t6-/m0/s1 |
| InChIKey | OLMMEIFPPJUTTI-LURJTMIESA-N |
| XLogP | -0.79 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2,4-bis(hydroxymethyl)-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,4-bis(hydroxymethyl)-2,3-dihydropyran-6-one?
The IUPAC name of (2S)-2,4-bis(hydroxymethyl)-2,3-dihydropyran-6-one (CID 130660381) is (2S)-2,4-bis(hydroxymethyl)-2,3-dihydropyran-6-one.
What is the SMILES notation for (2S)-2,4-bis(hydroxymethyl)-2,3-dihydropyran-6-one?
The canonical SMILES for (2S)-2,4-bis(hydroxymethyl)-2,3-dihydropyran-6-one is O=C1C=C(CO)C[C@@H](CO)O1.
What is the InChIKey of (2S)-2,4-bis(hydroxymethyl)-2,3-dihydropyran-6-one?
The InChIKey is OLMMEIFPPJUTTI-LURJTMIESA-N. The full InChI is InChI=1S/C7H10O4/c8-3-5-1-6(4-9)11-7(10)2-5/h2,6,8-9H,1,3-4H2/t6-/m0/s1.
What are the key properties of (2S)-2,4-bis(hydroxymethyl)-2,3-dihydropyran-6-one?
(2S)-2,4-bis(hydroxymethyl)-2,3-dihydropyran-6-one has a molecular weight of 158.15 g/mol, XLogP of -0.79, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,4-bis(hydroxymethyl)-2,3-dihydropyran-6-one is sourced from PubChem (CID 130660381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).