About 4-(2-fluoroethyl)-3,5-dimethylmorpholine
4-(2-fluoroethyl)-3,5-dimethylmorpholine (PubChem CID 130660973) has the molecular formula C8H16FNO
and a molecular weight of 161.22 g/mol. Its IUPAC name is 4-(2-fluoroethyl)-3,5-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-(2-fluoroethyl)-3,5-dimethylmorpholine |
| PubChem CID | 130660973 |
| Molecular Formula | C8H16FNO |
| Molecular Weight | 161.22 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 4-(2-fluoroethyl)-3,5-dimethylmorpholine |
| SMILES | CC1COCC(C)N1CCF |
| InChI | InChI=1S/C8H16FNO/c1-7-5-11-6-8(2)10(7)4-3-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | NMOAFAPHOJGQRQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-fluoroethyl)-3,5-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluoroethyl)-3,5-dimethylmorpholine?
The IUPAC name of 4-(2-fluoroethyl)-3,5-dimethylmorpholine (CID 130660973) is 4-(2-fluoroethyl)-3,5-dimethylmorpholine.
What is the SMILES notation for 4-(2-fluoroethyl)-3,5-dimethylmorpholine?
The canonical SMILES for 4-(2-fluoroethyl)-3,5-dimethylmorpholine is CC1COCC(C)N1CCF.
What is the InChIKey of 4-(2-fluoroethyl)-3,5-dimethylmorpholine?
The InChIKey is NMOAFAPHOJGQRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16FNO/c1-7-5-11-6-8(2)10(7)4-3-9/h7-8H,3-6H2,1-2H3.
What are the key properties of 4-(2-fluoroethyl)-3,5-dimethylmorpholine?
4-(2-fluoroethyl)-3,5-dimethylmorpholine has a molecular weight of 161.22 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluoroethyl)-3,5-dimethylmorpholine is sourced from PubChem (CID 130660973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).