About 1,1-dichlorocyclooctane
1,1-dichlorocyclooctane (PubChem CID 13066177) has the molecular formula C8H14Cl2
and a molecular weight of 181.11 g/mol. Its IUPAC name is 1,1-dichlorocyclooctane.
Molecular Properties
| Compound Name | 1,1-dichlorocyclooctane |
| PubChem CID | 13066177 |
| Molecular Formula | C8H14Cl2 |
| Molecular Weight | 181.11 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 1,1-dichlorocyclooctane |
| SMILES | ClC1(Cl)CCCCCCC1 |
| InChI | InChI=1S/C8H14Cl2/c9-8(10)6-4-2-1-3-5-7-8/h1-7H2 |
| InChIKey | XHNVGCYFMWQCAH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.11 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichlorocyclooctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichlorocyclooctane?
The IUPAC name of 1,1-dichlorocyclooctane (CID 13066177) is 1,1-dichlorocyclooctane.
What is the SMILES notation for 1,1-dichlorocyclooctane?
The canonical SMILES for 1,1-dichlorocyclooctane is ClC1(Cl)CCCCCCC1.
What is the InChIKey of 1,1-dichlorocyclooctane?
The InChIKey is XHNVGCYFMWQCAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14Cl2/c9-8(10)6-4-2-1-3-5-7-8/h1-7H2.
What are the key properties of 1,1-dichlorocyclooctane?
1,1-dichlorocyclooctane has a molecular weight of 181.11 g/mol, XLogP of 3.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichlorocyclooctane is sourced from PubChem (CID 13066177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).