About N,4-dimethyl-2-propan-2-yl-1,3-oxazole-5-carboxamide
N,4-dimethyl-2-propan-2-yl-1,3-oxazole-5-carboxamide (PubChem CID 130662850) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is N,4-dimethyl-2-propan-2-yl-1,3-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N,4-dimethyl-2-propan-2-yl-1,3-oxazole-5-carboxamide |
| PubChem CID | 130662850 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | N,4-dimethyl-2-propan-2-yl-1,3-oxazole-5-carboxamide |
| SMILES | CNC(=O)c1oc(C(C)C)nc1C |
| InChI | InChI=1S/C9H14N2O2/c1-5(2)9-11-6(3)7(13-9)8(12)10-4/h5H,1-4H3,(H,10,12) |
| InChIKey | VIXOEEGXMMEBBG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,4-dimethyl-2-propan-2-yl-1,3-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dimethyl-2-propan-2-yl-1,3-oxazole-5-carboxamide?
The IUPAC name of N,4-dimethyl-2-propan-2-yl-1,3-oxazole-5-carboxamide (CID 130662850) is N,4-dimethyl-2-propan-2-yl-1,3-oxazole-5-carboxamide.
What is the SMILES notation for N,4-dimethyl-2-propan-2-yl-1,3-oxazole-5-carboxamide?
The canonical SMILES for N,4-dimethyl-2-propan-2-yl-1,3-oxazole-5-carboxamide is CNC(=O)c1oc(C(C)C)nc1C.
What is the InChIKey of N,4-dimethyl-2-propan-2-yl-1,3-oxazole-5-carboxamide?
The InChIKey is VIXOEEGXMMEBBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-5(2)9-11-6(3)7(13-9)8(12)10-4/h5H,1-4H3,(H,10,12).
What are the key properties of N,4-dimethyl-2-propan-2-yl-1,3-oxazole-5-carboxamide?
N,4-dimethyl-2-propan-2-yl-1,3-oxazole-5-carboxamide has a molecular weight of 182.22 g/mol, XLogP of 1.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dimethyl-2-propan-2-yl-1,3-oxazole-5-carboxamide is sourced from PubChem (CID 130662850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).