C7H10F4N2S — CID 130663045
3-(3,3,4,4-tetrafluoropyrrolidin-1-yl)propanethioamide (PubChem CID 130663045) has the molecular formula C7H10F4N2S and a molecular weight of 230.23 g/mol. Its IUPAC name is 3-(3,3,4,4-tetrafluoropyrrolidin-1-yl)propanethioamide.
| Compound Name | 3-(3,3,4,4-tetrafluoropyrrolidin-1-yl)propanethioamide |
|---|---|
| PubChem CID | 130663045 |
| Molecular Formula | C7H10F4N2S |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 3-(3,3,4,4-tetrafluoropyrrolidin-1-yl)propanethioamide |
| SMILES | NC(=S)CCN1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C7H10F4N2S/c8-6(9)3-13(2-1-5(12)14)4-7(6,10)11/h1-4H2,(H2,12,14) |
| InChIKey | XCYHGRYFMNNWCE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|