About 2-methylsulfinyl-2,5-diazabicyclo[2.2.2]octane
2-methylsulfinyl-2,5-diazabicyclo[2.2.2]octane (PubChem CID 130664241) has the molecular formula C7H14N2OS
and a molecular weight of 174.27 g/mol. Its IUPAC name is 2-methylsulfinyl-2,5-diazabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | 2-methylsulfinyl-2,5-diazabicyclo[2.2.2]octane |
| PubChem CID | 130664241 |
| Molecular Formula | C7H14N2OS |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 2-methylsulfinyl-2,5-diazabicyclo[2.2.2]octane |
| SMILES | CS(=O)N1CC2CCC1CN2 |
| InChI | InChI=1S/C7H14N2OS/c1-11(10)9-5-6-2-3-7(9)4-8-6/h6-8H,2-5H2,1H3 |
| InChIKey | KMOMUDDVBFFUHV-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylsulfinyl-2,5-diazabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfinyl-2,5-diazabicyclo[2.2.2]octane?
The IUPAC name of 2-methylsulfinyl-2,5-diazabicyclo[2.2.2]octane (CID 130664241) is 2-methylsulfinyl-2,5-diazabicyclo[2.2.2]octane.
What is the SMILES notation for 2-methylsulfinyl-2,5-diazabicyclo[2.2.2]octane?
The canonical SMILES for 2-methylsulfinyl-2,5-diazabicyclo[2.2.2]octane is CS(=O)N1CC2CCC1CN2.
What is the InChIKey of 2-methylsulfinyl-2,5-diazabicyclo[2.2.2]octane?
The InChIKey is KMOMUDDVBFFUHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2OS/c1-11(10)9-5-6-2-3-7(9)4-8-6/h6-8H,2-5H2,1H3.
What are the key properties of 2-methylsulfinyl-2,5-diazabicyclo[2.2.2]octane?
2-methylsulfinyl-2,5-diazabicyclo[2.2.2]octane has a molecular weight of 174.27 g/mol, XLogP of -0.28, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfinyl-2,5-diazabicyclo[2.2.2]octane is sourced from PubChem (CID 130664241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).