C6H10F2N2O2S2 — CID 130664274
2-(3,3-difluoropyrrolidin-1-yl)sulfonylethanethioamide (PubChem CID 130664274) has the molecular formula C6H10F2N2O2S2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-(3,3-difluoropyrrolidin-1-yl)sulfonylethanethioamide.
| Compound Name | 2-(3,3-difluoropyrrolidin-1-yl)sulfonylethanethioamide |
|---|---|
| PubChem CID | 130664274 |
| Molecular Formula | C6H10F2N2O2S2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 2-(3,3-difluoropyrrolidin-1-yl)sulfonylethanethioamide |
| SMILES | NC(=S)CS(=O)(=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C6H10F2N2O2S2/c7-6(8)1-2-10(4-6)14(11,12)3-5(9)13/h1-4H2,(H2,9,13) |
| InChIKey | QHIUMZZQMUGGCU-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|